C29H40BrSi — CID 59561089
CID 59561089 (PubChem CID 59561089) has the molecular formula C29H40BrSi and a molecular weight of 496.63 g/mol.
| Compound Name | CID 59561089 |
|---|---|
| PubChem CID | 59561089 |
| Molecular Formula | C29H40BrSi |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc([Si])ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C29H40BrSi/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(30)15-17-25(27)26-18-16-24(31)22-28(26)29/h15-18,21-22H,3-14,19-20H2,1-2H3 |
| InChIKey | FXANGSUJVOBKSQ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|