C30H42Br2O2 — CID 59479587
2,7-dibromo-9,10-dioctylphenanthrene-9,10-diol (PubChem CID 59479587) has the molecular formula C30H42Br2O2 and a molecular weight of 594.47 g/mol. Its IUPAC name is 2,7-dibromo-9,10-dioctylphenanthrene-9,10-diol.
| Compound Name | 2,7-dibromo-9,10-dioctylphenanthrene-9,10-diol |
|---|---|
| PubChem CID | 59479587 |
| Molecular Formula | C30H42Br2O2 |
| Molecular Weight | 594.47 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 2,7-dibromo-9,10-dioctylphenanthrene-9,10-diol |
| SMILES | CCCCCCCCC1(O)c2cc(Br)ccc2-c2ccc(Br)cc2C1(O)CCCCCCCC |
| InChI | InChI=1S/C30H42Br2O2/c1-3-5-7-9-11-13-19-29(33)27-21-23(31)15-17-25(27)26-18-16-24(32)22-28(26)30(29,34)20-14-12-10-8-6-4-2/h15-18,21-22,33-34H,3-14,19-20H2,1-2H3 |
| InChIKey | BZGIBHVZMJYNFL-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.47 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|