C25H24Br2O — CID 58556168
2,7-dibromo-9-(4-hexylphenyl)fluoren-9-ol (PubChem CID 58556168) has the molecular formula C25H24Br2O and a molecular weight of 500.27 g/mol. Its IUPAC name is 2,7-dibromo-9-(4-hexylphenyl)fluoren-9-ol.
| Compound Name | 2,7-dibromo-9-(4-hexylphenyl)fluoren-9-ol |
|---|---|
| PubChem CID | 58556168 |
| Molecular Formula | C25H24Br2O |
| Molecular Weight | 500.27 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 2,7-dibromo-9-(4-hexylphenyl)fluoren-9-ol |
| SMILES | CCCCCCc1ccc(C2(O)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C25H24Br2O/c1-2-3-4-5-6-17-7-9-18(10-8-17)25(28)23-15-19(26)11-13-21(23)22-14-12-20(27)16-24(22)25/h7-16,28H,2-6H2,1H3 |
| InChIKey | JCDRLXPZGYGVBS-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.27 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|