C26H26Br2O — CID 134368344
2,7-dibromo-9-(3-hexyl-5-methylphenyl)fluoren-9-ol (PubChem CID 134368344) has the molecular formula C26H26Br2O and a molecular weight of 514.30 g/mol. Its IUPAC name is 2,7-dibromo-9-(3-hexyl-5-methylphenyl)fluoren-9-ol.
| Compound Name | 2,7-dibromo-9-(3-hexyl-5-methylphenyl)fluoren-9-ol |
|---|---|
| PubChem CID | 134368344 |
| Molecular Formula | C26H26Br2O |
| Molecular Weight | 514.30 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 2,7-dibromo-9-(3-hexyl-5-methylphenyl)fluoren-9-ol |
| SMILES | CCCCCCc1cc(C)cc(C2(O)c3cc(Br)ccc3-c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C26H26Br2O/c1-3-4-5-6-7-18-12-17(2)13-19(14-18)26(29)24-15-20(27)8-10-22(24)23-11-9-21(28)16-25(23)26/h8-16,29H,3-7H2,1-2H3 |
| InChIKey | IWGPDEDFBHRFNA-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.30 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|