C70H87Br5O2 — CID 158018153
1-bromo-3,5-dihexylbenzene;2,7-dibromo-3,6-diethylfluoren-9-one;2,7-dibromo-9-(3,5-dihexylphenyl)-3,6-diethylfluoren-9-ol (PubChem CID 158018153) has the molecular formula C70H87Br5O2 and a molecular weight of 1359.98 g/mol. Its IUPAC name is 1-bromo-3,5-dihexylbenzene;2,7-dibromo-3,6-diethylfluoren-9-one;2,7-dibromo-9-(3,5-dihexylphenyl)-3,6-diethylfluoren-9-ol.
| Compound Name | 1-bromo-3,5-dihexylbenzene;2,7-dibromo-3,6-diethylfluoren-9-one;2,7-dibromo-9-(3,5-dihexylphenyl)-3,6-diethylfluoren-9-ol |
|---|---|
| PubChem CID | 158018153 |
| Molecular Formula | C70H87Br5O2 |
| Molecular Weight | 1359.98 g/mol |
| Exact Mass | 1354.26 |
| IUPAC Name | 1-bromo-3,5-dihexylbenzene;2,7-dibromo-3,6-diethylfluoren-9-one;2,7-dibromo-9-(3,5-dihexylphenyl)-3,6-diethylfluoren-9-ol |
| SMILES | CCCCCCc1cc(Br)cc(CCCCCC)c1.CCCCCCc1cc(CCCCCC)cc(C2(O)c3cc(Br)c(CC)cc3-c3cc(CC)c(Br)cc32)c1.CCc1cc2c(cc1Br)C(=O)c1cc(Br)c(CC)cc1-2 |
| InChI | InChI=1S/C35H44Br2O.C18H29Br.C17H14Br2O/c1-5-9-11-13-15-24-17-25(16-14-12-10-6-2)19-28(18-24)35(38)31-22-33(36)26(7-3)20-29(31)30-21-27(8-4)34(37)23-32(30)35;1-3-5-7-9-11-16-13-17(15-18(19)14-16)12-10-8-6-4-2;1-3-9-5-11-12-6-10(4-2)16(19)8-14(12)17(20)13(11)7-15(9)18/h17-23,38H,5-16H2,1-4H3;13-15H,3-12H2,1-2H3;5-8H,3-4H2,1-2H3 |
| InChIKey | FFSQIVJLMXYKDF-UHFFFAOYSA-N |
| XLogP | 23.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1359.98 |
| LogP ≤ 5 | 23.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|