C20H31O2- — CID 140700736
2-(3,5-dihexylphenyl)acetate (PubChem CID 140700736) has the molecular formula C20H31O2- and a molecular weight of 303.47 g/mol. Its IUPAC name is 2-(3,5-dihexylphenyl)acetate.
| Compound Name | 2-(3,5-dihexylphenyl)acetate |
|---|---|
| PubChem CID | 140700736 |
| Molecular Formula | C20H31O2- |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 2-(3,5-dihexylphenyl)acetate |
| SMILES | CCCCCCc1cc(CCCCCC)cc(CC(=O)[O-])c1 |
| InChI | InChI=1S/C20H32O2/c1-3-5-7-9-11-17-13-18(12-10-8-6-4-2)15-19(14-17)16-20(21)22/h13-15H,3-12,16H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | ZKRZLLWCJPYOCK-UHFFFAOYSA-M |
| XLogP | 4.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|