C19H30O2 — CID 141246135
3,5-dihexylbenzoic acid (PubChem CID 141246135) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 3,5-dihexylbenzoic acid.
| Compound Name | 3,5-dihexylbenzoic acid |
|---|---|
| PubChem CID | 141246135 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 3,5-dihexylbenzoic acid |
| SMILES | CCCCCCc1cc(CCCCCC)cc(C(=O)O)c1 |
| InChI | InChI=1S/C19H30O2/c1-3-5-7-9-11-16-13-17(12-10-8-6-4-2)15-18(14-16)19(20)21/h13-15H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | STVFOXZZIWHIPW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|