About sodium;methane;2-(3-pentylphenyl)acetate
sodium;methane;2-(3-pentylphenyl)acetate (PubChem CID 157213915) has the molecular formula C14H21NaO2
and a molecular weight of 244.31 g/mol. Its IUPAC name is sodium;methane;2-(3-pentylphenyl)acetate.
Molecular Properties
| Compound Name | sodium;methane;2-(3-pentylphenyl)acetate |
| PubChem CID | 157213915 |
| Molecular Formula | C14H21NaO2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | sodium;methane;2-(3-pentylphenyl)acetate |
| SMILES | C.CCCCCc1cccc(CC(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C13H18O2.CH4.Na/c1-2-3-4-6-11-7-5-8-12(9-11)10-13(14)15;;/h5,7-9H,2-4,6,10H2,1H3,(H,14,15);1H4;/q;;+1/p-1 |
| InChIKey | RKVFNDLHSBFWLI-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;methane;2-(3-pentylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;methane;2-(3-pentylphenyl)acetate?
The IUPAC name of sodium;methane;2-(3-pentylphenyl)acetate (CID 157213915) is sodium;methane;2-(3-pentylphenyl)acetate.
What is the SMILES notation for sodium;methane;2-(3-pentylphenyl)acetate?
The canonical SMILES for sodium;methane;2-(3-pentylphenyl)acetate is C.CCCCCc1cccc(CC(=O)[O-])c1.[Na+].
What is the InChIKey of sodium;methane;2-(3-pentylphenyl)acetate?
The InChIKey is RKVFNDLHSBFWLI-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H18O2.CH4.Na/c1-2-3-4-6-11-7-5-8-12(9-11)10-13(14)15;;/h5,7-9H,2-4,6,10H2,1H3,(H,14,15);1H4;/q;;+1/p-1.
What are the key properties of sodium;methane;2-(3-pentylphenyl)acetate?
sodium;methane;2-(3-pentylphenyl)acetate has a molecular weight of 244.31 g/mol, XLogP of -0.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;methane;2-(3-pentylphenyl)acetate is sourced from PubChem (CID 157213915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).