C34H42Br2 — CID 90191586
2,7-dibromo-9-(3,5-dihexylphenyl)-3,6,9-trimethylfluorene (PubChem CID 90191586) has the molecular formula C34H42Br2 and a molecular weight of 610.52 g/mol. Its IUPAC name is 2,7-dibromo-9-(3,5-dihexylphenyl)-3,6,9-trimethylfluorene.
| Compound Name | 2,7-dibromo-9-(3,5-dihexylphenyl)-3,6,9-trimethylfluorene |
|---|---|
| PubChem CID | 90191586 |
| Molecular Formula | C34H42Br2 |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 2,7-dibromo-9-(3,5-dihexylphenyl)-3,6,9-trimethylfluorene |
| SMILES | CCCCCCc1cc(CCCCCC)cc(C2(C)c3cc(Br)c(C)cc3-c3cc(C)c(Br)cc32)c1 |
| InChI | InChI=1S/C34H42Br2/c1-6-8-10-12-14-25-18-26(15-13-11-9-7-2)20-27(19-25)34(5)30-21-32(35)23(3)16-28(30)29-17-24(4)33(36)22-31(29)34/h16-22H,6-15H2,1-5H3 |
| InChIKey | NREFGTUMJVBVII-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|