C46H66B2O4 — CID 90270791
2-[9-(3,5-dihexylphenyl)-3,6,9-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90270791) has the molecular formula C46H66B2O4 and a molecular weight of 704.65 g/mol. Its IUPAC name is 2-[9-(3,5-dihexylphenyl)-3,6,9-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9-(3,5-dihexylphenyl)-3,6,9-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90270791 |
| Molecular Formula | C46H66B2O4 |
| Molecular Weight | 704.65 g/mol |
| Exact Mass | 704.51 |
| IUPAC Name | 2-[9-(3,5-dihexylphenyl)-3,6,9-trimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCc1cc(CCCCCC)cc(C2(C)c3cc(B4OC(C)(C)C(C)(C)O4)c(C)cc3-c3cc(C)c(B4OC(C)(C)C(C)(C)O4)cc32)c1 |
| InChI | InChI=1S/C46H66B2O4/c1-14-16-18-20-22-33-26-34(23-21-19-17-15-2)28-35(27-33)46(13)38-29-40(47-49-42(5,6)43(7,8)50-47)31(3)24-36(38)37-25-32(4)41(30-39(37)46)48-51-44(9,10)45(11,12)52-48/h24-30H,14-23H2,1-13H3 |
| InChIKey | UPDQIPBKZDNTIX-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.65 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|