C44H60B2O4 — CID 123531502
2-[7-hexyl-3-[6-hexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123531502) has the molecular formula C44H60B2O4 and a molecular weight of 674.58 g/mol. Its IUPAC name is 2-[7-hexyl-3-[6-hexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[7-hexyl-3-[6-hexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123531502 |
| Molecular Formula | C44H60B2O4 |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.47 |
| IUPAC Name | 2-[7-hexyl-3-[6-hexyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCc1ccc2cc(-c3cc4ccc(CCCCCC)cc4cc3B3OC(C)(C)C(C)(C)O3)c(B3OC(C)(C)C(C)(C)O3)cc2c1 |
| InChI | InChI=1S/C44H60B2O4/c1-11-13-15-17-19-31-21-23-33-27-37(39(29-35(33)25-31)45-47-41(3,4)42(5,6)48-45)38-28-34-24-22-32(20-18-16-14-12-2)26-36(34)30-40(38)46-49-43(7,8)44(9,10)50-46/h21-30H,11-20H2,1-10H3 |
| InChIKey | IMVITECHXMARCN-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|