About 2-octylanthracene
2-octylanthracene (PubChem CID 23131226) has the molecular formula C22H26
and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-octylanthracene.
Molecular Properties
| Compound Name | 2-octylanthracene |
| PubChem CID | 23131226 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-octylanthracene |
| SMILES | CCCCCCCCc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C22H26/c1-2-3-4-5-6-7-10-18-13-14-21-16-19-11-8-9-12-20(19)17-22(21)15-18/h8-9,11-17H,2-7,10H2,1H3 |
| InChIKey | KMWZUEHYCNUSJO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-octylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylanthracene?
The IUPAC name of 2-octylanthracene (CID 23131226) is 2-octylanthracene.
What is the SMILES notation for 2-octylanthracene?
The canonical SMILES for 2-octylanthracene is CCCCCCCCc1ccc2cc3ccccc3cc2c1.
What is the InChIKey of 2-octylanthracene?
The InChIKey is KMWZUEHYCNUSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26/c1-2-3-4-5-6-7-10-18-13-14-21-16-19-11-8-9-12-20(19)17-22(21)15-18/h8-9,11-17H,2-7,10H2,1H3.
What are the key properties of 2-octylanthracene?
2-octylanthracene has a molecular weight of 290.45 g/mol, XLogP of 6.90, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylanthracene is sourced from PubChem (CID 23131226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).