About 2-pentylnaphthalene;prop-1-ene
2-pentylnaphthalene;prop-1-ene (PubChem CID 173098363) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-pentylnaphthalene;prop-1-ene.
Molecular Properties
| Compound Name | 2-pentylnaphthalene;prop-1-ene |
| PubChem CID | 173098363 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-pentylnaphthalene;prop-1-ene |
| SMILES | C=CC.CCCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H18.C3H6/c1-2-3-4-7-13-10-11-14-8-5-6-9-15(14)12-13;1-3-2/h5-6,8-12H,2-4,7H2,1H3;3H,1H2,2H3 |
| InChIKey | XFJOQJRJFFVPMT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylnaphthalene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylnaphthalene;prop-1-ene?
The IUPAC name of 2-pentylnaphthalene;prop-1-ene (CID 173098363) is 2-pentylnaphthalene;prop-1-ene.
What is the SMILES notation for 2-pentylnaphthalene;prop-1-ene?
The canonical SMILES for 2-pentylnaphthalene;prop-1-ene is C=CC.CCCCCc1ccc2ccccc2c1.
What is the InChIKey of 2-pentylnaphthalene;prop-1-ene?
The InChIKey is XFJOQJRJFFVPMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18.C3H6/c1-2-3-4-7-13-10-11-14-8-5-6-9-15(14)12-13;1-3-2/h5-6,8-12H,2-4,7H2,1H3;3H,1H2,2H3.
What are the key properties of 2-pentylnaphthalene;prop-1-ene?
2-pentylnaphthalene;prop-1-ene has a molecular weight of 240.39 g/mol, XLogP of 5.76, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylnaphthalene;prop-1-ene is sourced from PubChem (CID 173098363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).