About 2-butyltetracene
2-butyltetracene (PubChem CID 177478805) has the molecular formula C22H20
and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-butyltetracene.
Molecular Properties
| Compound Name | 2-butyltetracene |
| PubChem CID | 177478805 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-butyltetracene |
| SMILES | CCCCc1ccc2cc3cc4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C22H20/c1-2-3-6-16-9-10-19-14-21-12-17-7-4-5-8-18(17)13-22(21)15-20(19)11-16/h4-5,7-15H,2-3,6H2,1H3 |
| InChIKey | BRSLRGJESYPKBV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butyltetracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyltetracene?
The IUPAC name of 2-butyltetracene (CID 177478805) is 2-butyltetracene.
What is the SMILES notation for 2-butyltetracene?
The canonical SMILES for 2-butyltetracene is CCCCc1ccc2cc3cc4ccccc4cc3cc2c1.
What is the InChIKey of 2-butyltetracene?
The InChIKey is BRSLRGJESYPKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20/c1-2-3-6-16-9-10-19-14-21-12-17-7-4-5-8-18(17)13-22(21)15-20(19)11-16/h4-5,7-15H,2-3,6H2,1H3.
What are the key properties of 2-butyltetracene?
2-butyltetracene has a molecular weight of 284.40 g/mol, XLogP of 6.49, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyltetracene is sourced from PubChem (CID 177478805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).