C42H46BNO2 — CID 145332549
1-[9-(3-hexyl-5-methylphenyl)-9-methylfluoren-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (PubChem CID 145332549) has the molecular formula C42H46BNO2 and a molecular weight of 607.65 g/mol. Its IUPAC name is 1-[9-(3-hexyl-5-methylphenyl)-9-methylfluoren-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline.
| Compound Name | 1-[9-(3-hexyl-5-methylphenyl)-9-methylfluoren-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
|---|---|
| PubChem CID | 145332549 |
| Molecular Formula | C42H46BNO2 |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.36 |
| IUPAC Name | 1-[9-(3-hexyl-5-methylphenyl)-9-methylfluoren-2-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
| SMILES | CCCCCCc1cc(C)cc(C2(C)c3ccccc3-c3ccc(-c4ncc(B5OC(C)(C)C(C)(C)O5)c5ccccc45)cc32)c1 |
| InChI | InChI=1S/C42H46BNO2/c1-8-9-10-11-16-29-23-28(2)24-31(25-29)42(7)36-20-15-14-17-32(36)33-22-21-30(26-37(33)42)39-35-19-13-12-18-34(35)38(27-44-39)43-45-40(3,4)41(5,6)46-43/h12-15,17-27H,8-11,16H2,1-7H3 |
| InChIKey | OSWJGQDCXGZFTO-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|