C31H31BO3 — CID 168802712
2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 168802712) has the molecular formula C31H31BO3 and a molecular weight of 462.40 g/mol. Its IUPAC name is 2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 168802712 |
| Molecular Formula | C31H31BO3 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)Oc2cc(-c3ccc(B4OC(C)(C)C(C)(C)O4)c4ccccc34)ccc2-c2ccccc21 |
| InChI | InChI=1S/C31H31BO3/c1-29(2)26-14-10-9-12-23(26)25-16-15-20(19-28(25)33-29)21-17-18-27(24-13-8-7-11-22(21)24)32-34-30(3,4)31(5,6)35-32/h7-19H,1-6H3 |
| InChIKey | CMGQOCZNRZHENJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|