C59H40N6O — CID 168803005
2-[2-(6,6-dimethylbenzo[c]chromen-3-yl)-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 168803005) has the molecular formula C59H40N6O and a molecular weight of 849.01 g/mol. Its IUPAC name is 2-[2-(6,6-dimethylbenzo[c]chromen-3-yl)-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-(6,6-dimethylbenzo[c]chromen-3-yl)-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168803005 |
| Molecular Formula | C59H40N6O |
| Molecular Weight | 849.01 g/mol |
| Exact Mass | 848.33 |
| IUPAC Name | 2-[2-(6,6-dimethylbenzo[c]chromen-3-yl)-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)Oc2cc(-c3ccc(-c4nc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccccc21 |
| InChI | InChI=1S/C59H40N6O/c1-59(2)51-24-14-13-23-48(51)49-32-29-43(36-52(49)66-59)47-31-30-46(35-50(47)58-64-53(39-17-5-3-6-18-39)60-54(65-58)40-19-7-4-8-20-40)57-62-55(44-27-25-37-15-9-11-21-41(37)33-44)61-56(63-57)45-28-26-38-16-10-12-22-42(38)34-45/h3-36H,1-2H3 |
| InChIKey | PAYVZUKDTCESHC-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.01 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |