C67H45N7O — CID 168803106
9-[4-[4-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 168803106) has the molecular formula C67H45N7O and a molecular weight of 964.15 g/mol. Its IUPAC name is 9-[4-[4-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 9-[4-[4-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 168803106 |
| Molecular Formula | C67H45N7O |
| Molecular Weight | 964.15 g/mol |
| Exact Mass | 963.37 |
| IUPAC Name | 9-[4-[4-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | CC1(C)Oc2cc(-c3ccc(-c4nc(-c5ccc(-n6c7ccccc7c7ccccc76)cc5)nc(-c5ccc6ccccc6c5)n4)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccccc21 |
| InChI | InChI=1S/C67H45N7O/c1-67(2)57-26-14-11-23-52(57)55-38-33-47(41-60(55)75-67)51-37-34-49(40-56(51)66-72-61(43-18-5-3-6-19-43)68-62(73-66)44-20-7-4-8-21-44)65-70-63(69-64(71-65)48-30-29-42-17-9-10-22-46(42)39-48)45-31-35-50(36-32-45)74-58-27-15-12-24-53(58)54-25-13-16-28-59(54)74/h3-41H,1-2H3 |
| InChIKey | XETHCRGHIDTNCI-UHFFFAOYSA-N |
| XLogP | 16.27 |
| TPSA | 91.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.15 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |