C57H38N6O2S — CID 168802957
2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenoxathiin-3-yl-6-phenyl-1,3,5-triazine (PubChem CID 168802957) has the molecular formula C57H38N6O2S and a molecular weight of 871.04 g/mol. Its IUPAC name is 2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenoxathiin-3-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenoxathiin-3-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168802957 |
| Molecular Formula | C57H38N6O2S |
| Molecular Weight | 871.04 g/mol |
| Exact Mass | 870.28 |
| IUPAC Name | 2-[4-(6,6-dimethylbenzo[c]chromen-3-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenoxathiin-3-yl-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)Oc2cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)Oc5ccccc5S6)n4)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccccc21 |
| InChI | InChI=1S/C57H38N6O2S/c1-57(2)45-23-13-12-22-42(45)43-30-26-38(33-47(43)65-57)41-29-27-39(32-44(41)56-62-52(36-18-8-4-9-19-36)58-53(63-56)37-20-10-5-11-21-37)54-59-51(35-16-6-3-7-17-35)60-55(61-54)40-28-31-50-48(34-40)64-46-24-14-15-25-49(46)66-50/h3-34H,1-2H3 |
| InChIKey | HJLLSIKERHLNDO-UHFFFAOYSA-N |
| XLogP | 14.28 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.04 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |