C49H31N5OS — CID 174257791
2-[5-(2,6-diphenylpyrimidin-4-yl)-2-phenoxathiin-2-ylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 174257791) has the molecular formula C49H31N5OS and a molecular weight of 737.89 g/mol. Its IUPAC name is 2-[5-(2,6-diphenylpyrimidin-4-yl)-2-phenoxathiin-2-ylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[5-(2,6-diphenylpyrimidin-4-yl)-2-phenoxathiin-2-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174257791 |
| Molecular Formula | C49H31N5OS |
| Molecular Weight | 737.89 g/mol |
| Exact Mass | 737.22 |
| IUPAC Name | 2-[5-(2,6-diphenylpyrimidin-4-yl)-2-phenoxathiin-2-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc5c(c4)Sc4ccccc4O5)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C49H31N5OS/c1-5-15-32(16-6-1)40-31-41(51-46(50-40)33-17-7-2-8-18-33)37-25-27-38(36-26-28-43-45(30-36)56-44-24-14-13-23-42(44)55-43)39(29-37)49-53-47(34-19-9-3-10-20-34)52-48(54-49)35-21-11-4-12-22-35/h1-31H |
| InChIKey | QKNMUVZMJLDCSN-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.89 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |