C49H31N5S2 — CID 174259355
2-[3-(2,6-diphenylpyrimidin-4-yl)-4-thianthren-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 174259355) has the molecular formula C49H31N5S2 and a molecular weight of 753.96 g/mol. Its IUPAC name is 2-[3-(2,6-diphenylpyrimidin-4-yl)-4-thianthren-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(2,6-diphenylpyrimidin-4-yl)-4-thianthren-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174259355 |
| Molecular Formula | C49H31N5S2 |
| Molecular Weight | 753.96 g/mol |
| Exact Mass | 753.20 |
| IUPAC Name | 2-[3-(2,6-diphenylpyrimidin-4-yl)-4-thianthren-1-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3-c3cccc4c3Sc3ccccc3S4)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C49H31N5S2/c1-5-16-32(17-6-1)40-31-41(51-46(50-40)33-18-7-2-8-19-33)39-30-36(28-29-37(39)38-24-15-27-44-45(38)56-43-26-14-13-25-42(43)55-44)49-53-47(34-20-9-3-10-21-34)52-48(54-49)35-22-11-4-12-23-35/h1-31H |
| InChIKey | RXTPQHRHBLVTNU-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.96 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |