C52H36N2 — CID 121450646
2,4-diphenyl-6-[3-[3-[4-phenyl-3-(2-phenylphenyl)phenyl]phenyl]phenyl]pyrimidine (PubChem CID 121450646) has the molecular formula C52H36N2 and a molecular weight of 688.87 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-[3-[4-phenyl-3-(2-phenylphenyl)phenyl]phenyl]phenyl]pyrimidine.
| Compound Name | 2,4-diphenyl-6-[3-[3-[4-phenyl-3-(2-phenylphenyl)phenyl]phenyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 121450646 |
| Molecular Formula | C52H36N2 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | 2,4-diphenyl-6-[3-[3-[4-phenyl-3-(2-phenylphenyl)phenyl]phenyl]phenyl]pyrimidine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4cccc(-c5ccc(-c6ccccc6)c(-c6ccccc6-c6ccccc6)c5)c4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C52H36N2/c1-5-17-37(18-6-1)46-29-13-14-30-48(46)49-35-44(31-32-47(49)38-19-7-2-8-20-38)42-26-15-25-41(33-42)43-27-16-28-45(34-43)51-36-50(39-21-9-3-10-22-39)53-52(54-51)40-23-11-4-12-24-40/h1-36H |
| InChIKey | NYAZNBXRVGDZHV-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |