C51H35N3 — CID 171052601
2-(3-phenylphenyl)-4-(4-phenylphenyl)-6-[3-phenyl-4-(2-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 171052601) has the molecular formula C51H35N3 and a molecular weight of 689.86 g/mol. Its IUPAC name is 2-(3-phenylphenyl)-4-(4-phenylphenyl)-6-[3-phenyl-4-(2-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(3-phenylphenyl)-4-(4-phenylphenyl)-6-[3-phenyl-4-(2-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171052601 |
| Molecular Formula | C51H35N3 |
| Molecular Weight | 689.86 g/mol |
| Exact Mass | 689.28 |
| IUPAC Name | 2-(3-phenylphenyl)-4-(4-phenylphenyl)-6-[3-phenyl-4-(2-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4ccc(-c5ccccc5-c5ccccc5)c(-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C51H35N3/c1-5-16-36(17-6-1)38-28-30-41(31-29-38)49-52-50(43-25-15-24-42(34-43)37-18-7-2-8-19-37)54-51(53-49)44-32-33-47(48(35-44)40-22-11-4-12-23-40)46-27-14-13-26-45(46)39-20-9-3-10-21-39/h1-35H |
| InChIKey | PZMAXLAASCQDPY-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.86 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |