C45H31N3 — CID 171052590
2-(2,5-diphenylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 171052590) has the molecular formula C45H31N3 and a molecular weight of 613.76 g/mol. Its IUPAC name is 2-(2,5-diphenylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(2,5-diphenylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171052590 |
| Molecular Formula | C45H31N3 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 2-(2,5-diphenylphenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4cc(-c5ccccc5)ccc4-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C45H31N3/c1-5-15-32(16-6-1)36-23-13-25-39(29-36)43-46-44(40-26-14-24-37(30-40)33-17-7-2-8-18-33)48-45(47-43)42-31-38(34-19-9-3-10-20-34)27-28-41(42)35-21-11-4-12-22-35/h1-31H |
| InChIKey | CHHVVQOCLKPZBA-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |