About 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine
2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 171052509) has the molecular formula C39H27N3
and a molecular weight of 537.67 g/mol. Its IUPAC name is 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| PubChem CID | 171052509 |
| Molecular Formula | C39H27N3 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)ccc4-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C39H27N3/c1-5-13-28(14-6-1)30-21-23-33(24-22-30)38-40-37(32-19-11-4-12-20-32)41-39(42-38)36-27-34(29-15-7-2-8-16-29)25-26-35(36)31-17-9-3-10-18-31/h1-27H |
| InChIKey | YESXWJKBHLJPIB-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine?
The IUPAC name of 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (CID 171052509) is 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
What is the SMILES notation for 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine?
The canonical SMILES for 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine is c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)ccc4-c4ccccc4)n3)cc2)cc1.
What is the InChIKey of 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine?
The InChIKey is YESXWJKBHLJPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H27N3/c1-5-13-28(14-6-1)30-21-23-33(24-22-30)38-40-37(32-19-11-4-12-20-32)41-39(42-38)36-27-34(29-15-7-2-8-16-29)25-26-35(36)31-17-9-3-10-18-31/h1-27H.
What are the key properties of 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine?
2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine has a molecular weight of 537.67 g/mol, XLogP of 9.87, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-diphenylphenyl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine is sourced from PubChem (CID 171052509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).