C39H23N3O2S — CID 165382224
2-(9-phenoxathiin-3-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 165382224) has the molecular formula C39H23N3O2S and a molecular weight of 597.70 g/mol. Its IUPAC name is 2-(9-phenoxathiin-3-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(9-phenoxathiin-3-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 165382224 |
| Molecular Formula | C39H23N3O2S |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | 2-(9-phenoxathiin-3-yldibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3cccc(-c5ccc6c(c5)Oc5ccccc5S6)c34)n2)cc1 |
| InChI | InChI=1S/C39H23N3O2S/c1-3-10-24(11-4-1)37-40-38(25-12-5-2-6-13-25)42-39(41-37)27-18-20-29-32(23-27)44-31-16-9-14-28(36(29)31)26-19-21-35-33(22-26)43-30-15-7-8-17-34(30)45-35/h1-23H |
| InChIKey | RCJKMJDZLICMDS-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |