C57H39N7O2 — CID 168802896
10-[4-[4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-dimethylbenzo[c]chromen-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine (PubChem CID 168802896) has the molecular formula C57H39N7O2 and a molecular weight of 853.99 g/mol. Its IUPAC name is 10-[4-[4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-dimethylbenzo[c]chromen-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine.
| Compound Name | 10-[4-[4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-dimethylbenzo[c]chromen-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 168802896 |
| Molecular Formula | C57H39N7O2 |
| Molecular Weight | 853.99 g/mol |
| Exact Mass | 853.32 |
| IUPAC Name | 10-[4-[4-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6-dimethylbenzo[c]chromen-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine |
| SMILES | CC1(C)Oc2cc(-c3nc(-c4ccccc4)nc(-c4ccc(N5c6ccccc6Oc6ccccc65)cc4)n3)ccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C57H39N7O2/c1-57(2)45-34-40(55-60-51(36-16-6-3-7-17-36)58-52(61-55)37-18-8-4-9-19-37)28-32-43(45)44-33-29-41(35-50(44)66-57)56-62-53(38-20-10-5-11-21-38)59-54(63-56)39-26-30-42(31-27-39)64-46-22-12-14-24-48(46)65-49-25-15-13-23-47(49)64/h3-35H,1-2H3 |
| InChIKey | VQTICFDSHLDLDF-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 99.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.99 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |