C66H42N8O2 — CID 129291614
10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenoxazin-10-ylphenyl]phenyl]phenoxazine (PubChem CID 129291614) has the molecular formula C66H42N8O2 and a molecular weight of 979.12 g/mol. Its IUPAC name is 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenoxazin-10-ylphenyl]phenyl]phenoxazine.
| Compound Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenoxazin-10-ylphenyl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 129291614 |
| Molecular Formula | C66H42N8O2 |
| Molecular Weight | 979.12 g/mol |
| Exact Mass | 978.34 |
| IUPAC Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenoxazin-10-ylphenyl]phenyl]phenoxazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc(N5c6ccccc6Oc6ccccc65)c4)cc(N4c5ccccc5Oc5ccccc54)c3)n2)cc1 |
| InChI | InChI=1S/C66H42N8O2/c1-5-21-43(22-6-1)61-67-62(44-23-7-2-8-24-44)70-65(69-61)49-37-47(39-51(41-49)73-53-29-13-17-33-57(53)75-58-34-18-14-30-54(58)73)48-38-50(42-52(40-48)74-55-31-15-19-35-59(55)76-60-36-20-16-32-56(60)74)66-71-63(45-25-9-3-10-26-45)68-64(72-66)46-27-11-4-12-28-46/h1-42H |
| InChIKey | GLOAQTOTCVQZGK-UHFFFAOYSA-N |
| XLogP | 16.88 |
| TPSA | 102.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.12 |
| LogP ≤ 5 | 16.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |