C68H44N6OS — CID 129291660
10-[3-(2,6-diphenylpyrimidin-4-yl)-5-[3-(4,6-diphenylpyrimidin-2-yl)-5-phenothiazin-10-ylphenyl]phenyl]phenoxazine (PubChem CID 129291660) has the molecular formula C68H44N6OS and a molecular weight of 993.21 g/mol. Its IUPAC name is 10-[3-(2,6-diphenylpyrimidin-4-yl)-5-[3-(4,6-diphenylpyrimidin-2-yl)-5-phenothiazin-10-ylphenyl]phenyl]phenoxazine.
| Compound Name | 10-[3-(2,6-diphenylpyrimidin-4-yl)-5-[3-(4,6-diphenylpyrimidin-2-yl)-5-phenothiazin-10-ylphenyl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 129291660 |
| Molecular Formula | C68H44N6OS |
| Molecular Weight | 993.21 g/mol |
| Exact Mass | 992.33 |
| IUPAC Name | 10-[3-(2,6-diphenylpyrimidin-4-yl)-5-[3-(4,6-diphenylpyrimidin-2-yl)-5-phenothiazin-10-ylphenyl]phenyl]phenoxazine |
| SMILES | c1ccc(-c2cc(-c3cc(-c4cc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cc(N5c6ccccc6Sc6ccccc65)c4)cc(N4c5ccccc5Oc5ccccc54)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C68H44N6OS/c1-5-21-45(22-6-1)55-43-56(46-23-7-2-8-24-46)71-68(70-55)52-38-50(40-54(42-52)74-61-31-15-19-35-65(61)76-66-36-20-16-32-62(66)74)49-37-51(41-53(39-49)73-59-29-13-17-33-63(59)75-64-34-18-14-30-60(64)73)58-44-57(47-25-9-3-10-26-47)69-67(72-58)48-27-11-4-12-28-48/h1-44H |
| InChIKey | QVDSCOQYAZYTLJ-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.21 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |