C53H39N3 — CID 118427115
2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine (PubChem CID 118427115) has the molecular formula C53H39N3 and a molecular weight of 717.92 g/mol. Its IUPAC name is 2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 118427115 |
| Molecular Formula | C53H39N3 |
| Molecular Weight | 717.92 g/mol |
| Exact Mass | 717.31 |
| IUPAC Name | 2-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5nc(-c6ccc7ccccc7c6)nc(-c6ccc7ccccc7c6)n5)ccc3-4)cc21 |
| InChI | InChI=1S/C53H39N3/c1-52(2)45-16-10-9-15-41(45)42-24-21-36(29-46(42)52)37-22-25-43-44-26-23-40(31-48(44)53(3,4)47(43)30-37)51-55-49(38-19-17-32-11-5-7-13-34(32)27-38)54-50(56-51)39-20-18-33-12-6-8-14-35(33)28-39/h5-31H,1-4H3 |
| InChIKey | MIMCTZNJPKJATR-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.92 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |