C63H47N3 — CID 118530501
2,4-bis[3-[3-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 118530501) has the molecular formula C63H47N3 and a molecular weight of 846.09 g/mol. Its IUPAC name is 2,4-bis[3-[3-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2,4-bis[3-[3-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118530501 |
| Molecular Formula | C63H47N3 |
| Molecular Weight | 846.09 g/mol |
| Exact Mass | 845.38 |
| IUPAC Name | 2,4-bis[3-[3-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6cccc(-c7cccc(-c8ccc9c(c8)C(C)(C)c8ccccc8-9)c7)c6)n5)c4)c3)cc21 |
| InChI | InChI=1S/C63H47N3/c1-62(2)55-28-10-8-26-51(55)53-32-30-47(38-57(53)62)43-20-12-18-41(34-43)45-22-14-24-49(36-45)60-64-59(40-16-6-5-7-17-40)65-61(66-60)50-25-15-23-46(37-50)42-19-13-21-44(35-42)48-31-33-54-52-27-9-11-29-56(52)63(3,4)58(54)39-48/h5-39H,1-4H3 |
| InChIKey | RPEFIRUOIVOMOU-UHFFFAOYSA-N |
| XLogP | 16.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.09 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |