C49H35N3 — CID 121241565
2-[3-[6-(9,9-dimethylfluoren-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 121241565) has the molecular formula C49H35N3 and a molecular weight of 665.84 g/mol. Its IUPAC name is 2-[3-[6-(9,9-dimethylfluoren-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[6-(9,9-dimethylfluoren-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 121241565 |
| Molecular Formula | C49H35N3 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | 2-[3-[6-(9,9-dimethylfluoren-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc4c(c3)-c3cc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)ccc3C4)cc21 |
| InChI | InChI=1S/C49H35N3/c1-49(2)44-19-10-9-18-40(44)41-25-24-36(30-45(41)49)35-21-23-38-27-37-22-20-34(28-42(37)43(38)29-35)33-16-11-17-39(26-33)48-51-46(31-12-5-3-6-13-31)50-47(52-48)32-14-7-4-8-15-32/h3-26,28-30H,27H2,1-2H3 |
| InChIKey | WXMHRUPLOFMHPN-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |