C43H31N3 — CID 118685410
2-(9,9-dimethylfluoren-2-yl)-4-phenyl-6-(8-phenyl-9H-fluoren-3-yl)-1,3,5-triazine (PubChem CID 118685410) has the molecular formula C43H31N3 and a molecular weight of 589.74 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-phenyl-6-(8-phenyl-9H-fluoren-3-yl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-phenyl-6-(8-phenyl-9H-fluoren-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118685410 |
| Molecular Formula | C43H31N3 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-phenyl-6-(8-phenyl-9H-fluoren-3-yl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)-c4cccc(-c6ccccc6)c4C5)n3)cc21 |
| InChI | InChI=1S/C43H31N3/c1-43(2)38-19-10-9-16-34(38)35-23-22-31(26-39(35)43)42-45-40(28-14-7-4-8-15-28)44-41(46-42)30-21-20-29-24-37-32(27-12-5-3-6-13-27)17-11-18-33(37)36(29)25-30/h3-23,25-26H,24H2,1-2H3 |
| InChIKey | RXURTPULBGOMPO-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |