C63H51N3 — CID 144558249
2-[3-[3-(9H-fluoren-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine;toluene;2,9,9-trimethylfluorene (PubChem CID 144558249) has the molecular formula C63H51N3 and a molecular weight of 850.12 g/mol. Its IUPAC name is 2-[3-[3-(9H-fluoren-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine;toluene;2,9,9-trimethylfluorene.
| Compound Name | 2-[3-[3-(9H-fluoren-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine;toluene;2,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 144558249 |
| Molecular Formula | C63H51N3 |
| Molecular Weight | 850.12 g/mol |
| Exact Mass | 849.41 |
| IUPAC Name | 2-[3-[3-(9H-fluoren-3-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine;toluene;2,9,9-trimethylfluorene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1ccccc1-2.Cc1ccccc1.c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5ccc6c(c5)-c5ccccc5C6)c4)c3)n2)cc1 |
| InChI | InChI=1S/C40H27N3.C16H16.C7H8/c1-3-11-27(12-4-1)38-41-39(28-13-5-2-6-14-28)43-40(42-38)35-19-10-18-31(24-35)29-16-9-17-30(23-29)32-21-22-34-25-33-15-7-8-20-36(33)37(34)26-32;1-11-8-9-13-12-6-4-5-7-14(12)16(2,3)15(13)10-11;1-7-5-3-2-4-6-7/h1-24,26H,25H2;4-10H,1-3H3;2-6H,1H3 |
| InChIKey | LYUPIWSAVOOOLX-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.12 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |