C34H23N3 — CID 158076538
2-[3-(9H-fluoren-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 158076538) has the molecular formula C34H23N3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-[3-(9H-fluoren-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(9H-fluoren-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 158076538 |
| Molecular Formula | C34H23N3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[3-(9H-fluoren-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)Cc4ccccc4-5)c3)n2)cc1 |
| InChI | InChI=1S/C34H23N3/c1-3-10-23(11-4-1)32-35-33(24-12-5-2-6-13-24)37-34(36-32)28-16-9-15-25(20-28)26-18-19-31-29(21-26)22-27-14-7-8-17-30(27)31/h1-21H,22H2 |
| InChIKey | QOQFDZBLWONMKP-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |