C41H31N3 — CID 161009939
2,4-diphenyl-6-[3-(8-phenyl-9H-fluoren-3-yl)phenyl]-1,3,5-triazine;methane (PubChem CID 161009939) has the molecular formula C41H31N3 and a molecular weight of 565.72 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-(8-phenyl-9H-fluoren-3-yl)phenyl]-1,3,5-triazine;methane.
| Compound Name | 2,4-diphenyl-6-[3-(8-phenyl-9H-fluoren-3-yl)phenyl]-1,3,5-triazine;methane |
|---|---|
| PubChem CID | 161009939 |
| Molecular Formula | C41H31N3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 2,4-diphenyl-6-[3-(8-phenyl-9H-fluoren-3-yl)phenyl]-1,3,5-triazine;methane |
| SMILES | C.c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)-c4cccc(-c6ccccc6)c4C5)c3)n2)cc1 |
| InChI | InChI=1S/C40H27N3.CH4/c1-4-12-27(13-5-1)34-20-11-21-35-36-25-31(22-23-32(36)26-37(34)35)30-18-10-19-33(24-30)40-42-38(28-14-6-2-7-15-28)41-39(43-40)29-16-8-3-9-17-29;/h1-25H,26H2;1H4 |
| InChIKey | TWZRFBQKZQVAGM-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |