C46H31N3 — CID 118685423
2,4-diphenyl-6-[3-[8-(3-phenylphenyl)-9H-fluoren-3-yl]phenyl]-1,3,5-triazine (PubChem CID 118685423) has the molecular formula C46H31N3 and a molecular weight of 625.78 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-[8-(3-phenylphenyl)-9H-fluoren-3-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-[8-(3-phenylphenyl)-9H-fluoren-3-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 118685423 |
| Molecular Formula | C46H31N3 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 2,4-diphenyl-6-[3-[8-(3-phenylphenyl)-9H-fluoren-3-yl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3cccc4c3Cc3ccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)cc3-4)c2)cc1 |
| InChI | InChI=1S/C46H31N3/c1-4-13-31(14-5-1)34-19-10-21-37(27-34)40-23-12-24-41-42-29-36(25-26-38(42)30-43(40)41)35-20-11-22-39(28-35)46-48-44(32-15-6-2-7-16-32)47-45(49-46)33-17-8-3-9-18-33/h1-29H,30H2 |
| InChIKey | NXMBQJFWZYOVJL-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |