C53H39N3 — CID 159816349
2-[3-(3,6-diphenyl-9H-fluoren-1-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine;methane (PubChem CID 159816349) has the molecular formula C53H39N3 and a molecular weight of 717.92 g/mol. Its IUPAC name is 2-[3-(3,6-diphenyl-9H-fluoren-1-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine;methane.
| Compound Name | 2-[3-(3,6-diphenyl-9H-fluoren-1-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine;methane |
|---|---|
| PubChem CID | 159816349 |
| Molecular Formula | C53H39N3 |
| Molecular Weight | 717.92 g/mol |
| Exact Mass | 717.31 |
| IUPAC Name | 2-[3-(3,6-diphenyl-9H-fluoren-1-yl)-5-phenylphenyl]-4,6-diphenyl-1,3,5-triazine;methane |
| SMILES | C.c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cc(-c4ccccc4)cc4c3Cc3ccc(-c5ccccc5)cc3-4)c2)cc1 |
| InChI | InChI=1S/C52H35N3.CH4/c1-6-16-35(17-7-1)40-26-27-41-32-48-47(33-43(34-49(48)46(41)31-40)37-20-10-3-11-21-37)44-28-42(36-18-8-2-9-19-36)29-45(30-44)52-54-50(38-22-12-4-13-23-38)53-51(55-52)39-24-14-5-15-25-39;/h1-31,33-34H,32H2;1H4 |
| InChIKey | NLQYBVSOTUTJTN-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.92 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |