C33H22N4 — CID 161248550
2-[2-(9H-fluoren-2-yl)-4-pyridinyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 161248550) has the molecular formula C33H22N4 and a molecular weight of 474.57 g/mol. Its IUPAC name is 2-[2-(9H-fluoren-2-yl)-4-pyridinyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-(9H-fluoren-2-yl)-4-pyridinyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 161248550 |
| Molecular Formula | C33H22N4 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[2-(9H-fluoren-2-yl)-4-pyridinyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccnc(-c4ccc5c(c4)Cc4ccccc4-5)c3)n2)cc1 |
| InChI | InChI=1S/C33H22N4/c1-3-9-22(10-4-1)31-35-32(23-11-5-2-6-12-23)37-33(36-31)26-17-18-34-30(21-26)25-15-16-29-27(20-25)19-24-13-7-8-14-28(24)29/h1-18,20-21H,19H2 |
| InChIKey | VAYPYHJCUTXYFC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |