C25H18N6 — CID 118183672
2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]pyridin-4-amine (PubChem CID 118183672) has the molecular formula C25H18N6 and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]pyridin-4-amine.
| Compound Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]pyridin-4-amine |
|---|---|
| PubChem CID | 118183672 |
| Molecular Formula | C25H18N6 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-pyridinyl]pyridin-4-amine |
| SMILES | Nc1ccnc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccn2)c1 |
| InChI | InChI=1S/C25H18N6/c26-20-12-14-28-22(16-20)21-15-19(11-13-27-21)25-30-23(17-7-3-1-4-8-17)29-24(31-25)18-9-5-2-6-10-18/h1-16H,(H2,26,28) |
| InChIKey | ZWVOTBSJUCEMCC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |