C15H11ClN4 — CID 170034814
3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)aniline (PubChem CID 170034814) has the molecular formula C15H11ClN4 and a molecular weight of 282.73 g/mol. Its IUPAC name is 3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)aniline.
| Compound Name | 3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)aniline |
|---|---|
| PubChem CID | 170034814 |
| Molecular Formula | C15H11ClN4 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)aniline |
| SMILES | Nc1cccc(-c2nc(Cl)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C15H11ClN4/c16-15-19-13(10-5-2-1-3-6-10)18-14(20-15)11-7-4-8-12(17)9-11/h1-9H,17H2 |
| InChIKey | WYDYNZQPZCPPPT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|