C15H10ClN3O — CID 137370789
3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenol (PubChem CID 137370789) has the molecular formula C15H10ClN3O and a molecular weight of 283.72 g/mol. Its IUPAC name is 3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenol.
| Compound Name | 3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 137370789 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenol |
| SMILES | Oc1cccc(-c2nc(Cl)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C15H10ClN3O/c16-15-18-13(10-5-2-1-3-6-10)17-14(19-15)11-7-4-8-12(20)9-11/h1-9,20H |
| InChIKey | HBZAEERIYLCMHO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |