C42H30BCl3N6O2 — CID 159203578
2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;phenylboronic acid (PubChem CID 159203578) has the molecular formula C42H30BCl3N6O2 and a molecular weight of 767.91 g/mol. Its IUPAC name is 2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;phenylboronic acid.
| Compound Name | 2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;phenylboronic acid |
|---|---|
| PubChem CID | 159203578 |
| Molecular Formula | C42H30BCl3N6O2 |
| Molecular Weight | 767.91 g/mol |
| Exact Mass | 766.16 |
| IUPAC Name | 2-chloro-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;phenylboronic acid |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2cccc(-c3ccccc3)c2)n1.Clc1nc(Cl)nc(-c2cccc(-c3ccccc3)c2)n1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C21H14ClN3.C15H9Cl2N3.C6H7BO2/c22-21-24-19(16-10-5-2-6-11-16)23-20(25-21)18-13-7-12-17(14-18)15-8-3-1-4-9-15;16-14-18-13(19-15(17)20-14)12-8-4-7-11(9-12)10-5-2-1-3-6-10;8-7(9)6-4-2-1-3-5-6/h1-14H;1-9H;1-5,8-9H |
| InChIKey | KPPCFBPLQCVHQD-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.91 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|