C54H36BCl5N6O2 — CID 161053380
2,4-bis(3-chlorophenyl)-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4,6-bis(3-chlorophenyl)-1,3,5-triazine;(3-phenylphenyl)boronic acid (PubChem CID 161053380) has the molecular formula C54H36BCl5N6O2 and a molecular weight of 989.00 g/mol. Its IUPAC name is 2,4-bis(3-chlorophenyl)-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4,6-bis(3-chlorophenyl)-1,3,5-triazine;(3-phenylphenyl)boronic acid.
| Compound Name | 2,4-bis(3-chlorophenyl)-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4,6-bis(3-chlorophenyl)-1,3,5-triazine;(3-phenylphenyl)boronic acid |
|---|---|
| PubChem CID | 161053380 |
| Molecular Formula | C54H36BCl5N6O2 |
| Molecular Weight | 989.00 g/mol |
| Exact Mass | 986.14 |
| IUPAC Name | 2,4-bis(3-chlorophenyl)-6-(3-phenylphenyl)-1,3,5-triazine;2-chloro-4,6-bis(3-chlorophenyl)-1,3,5-triazine;(3-phenylphenyl)boronic acid |
| SMILES | Clc1cccc(-c2nc(-c3cccc(Cl)c3)nc(-c3cccc(-c4ccccc4)c3)n2)c1.Clc1cccc(-c2nc(Cl)nc(-c3cccc(Cl)c3)n2)c1.OB(O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H17Cl2N3.C15H8Cl3N3.C12H11BO2/c28-23-13-5-11-21(16-23)26-30-25(31-27(32-26)22-12-6-14-24(29)17-22)20-10-4-9-19(15-20)18-7-2-1-3-8-18;16-11-5-1-3-9(7-11)13-19-14(21-15(18)20-13)10-4-2-6-12(17)8-10;14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-17H;1-8H;1-9,14-15H |
| InChIKey | UCKWNSJTFXESOF-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.00 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|