C36H22BBr2Cl5N6O2 — CID 157091548
2-(3-bromophenyl)-4,6-bis(3-chlorophenyl)-1,3,5-triazine;2-(3-bromophenyl)-4,6-dichloro-1,3,5-triazine;(3-chlorophenyl)boronic acid (PubChem CID 157091548) has the molecular formula C36H22BBr2Cl5N6O2 and a molecular weight of 918.50 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4,6-bis(3-chlorophenyl)-1,3,5-triazine;2-(3-bromophenyl)-4,6-dichloro-1,3,5-triazine;(3-chlorophenyl)boronic acid.
| Compound Name | 2-(3-bromophenyl)-4,6-bis(3-chlorophenyl)-1,3,5-triazine;2-(3-bromophenyl)-4,6-dichloro-1,3,5-triazine;(3-chlorophenyl)boronic acid |
|---|---|
| PubChem CID | 157091548 |
| Molecular Formula | C36H22BBr2Cl5N6O2 |
| Molecular Weight | 918.50 g/mol |
| Exact Mass | 913.87 |
| IUPAC Name | 2-(3-bromophenyl)-4,6-bis(3-chlorophenyl)-1,3,5-triazine;2-(3-bromophenyl)-4,6-dichloro-1,3,5-triazine;(3-chlorophenyl)boronic acid |
| SMILES | Clc1cccc(-c2nc(-c3cccc(Cl)c3)nc(-c3cccc(Br)c3)n2)c1.Clc1nc(Cl)nc(-c2cccc(Br)c2)n1.OB(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H12BrCl2N3.C9H4BrCl2N3.C6H6BClO2/c22-16-7-1-4-13(10-16)19-25-20(14-5-2-8-17(23)11-14)27-21(26-19)15-6-3-9-18(24)12-15;10-6-3-1-2-5(4-6)7-13-8(11)15-9(12)14-7;8-6-3-1-2-5(4-6)7(9)10/h1-12H;1-4H;1-4,9-10H |
| InChIKey | AESLQIRUTPGSRU-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.50 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|