C44H32BCl3N4O2 — CID 159075593
4-chloro-2,6-diphenylpyrimidine;(3-chlorophenyl)boronic acid;4-(3-chlorophenyl)-2,6-diphenylpyrimidine (PubChem CID 159075593) has the molecular formula C44H32BCl3N4O2 and a molecular weight of 765.94 g/mol. Its IUPAC name is 4-chloro-2,6-diphenylpyrimidine;(3-chlorophenyl)boronic acid;4-(3-chlorophenyl)-2,6-diphenylpyrimidine.
| Compound Name | 4-chloro-2,6-diphenylpyrimidine;(3-chlorophenyl)boronic acid;4-(3-chlorophenyl)-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 159075593 |
| Molecular Formula | C44H32BCl3N4O2 |
| Molecular Weight | 765.94 g/mol |
| Exact Mass | 764.17 |
| IUPAC Name | 4-chloro-2,6-diphenylpyrimidine;(3-chlorophenyl)boronic acid;4-(3-chlorophenyl)-2,6-diphenylpyrimidine |
| SMILES | Clc1cc(-c2ccccc2)nc(-c2ccccc2)n1.Clc1cccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1.OB(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H15ClN2.C16H11ClN2.C6H6BClO2/c23-19-13-7-12-18(14-19)21-15-20(16-8-3-1-4-9-16)24-22(25-21)17-10-5-2-6-11-17;17-15-11-14(12-7-3-1-4-8-12)18-16(19-15)13-9-5-2-6-10-13;8-6-3-1-2-5(4-6)7(9)10/h1-15H;1-11H;1-4,9-10H |
| InChIKey | KAFAWHIMORXKJC-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.94 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|