C28H21BN2O2 — CID 156900613
[3-[6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]phenyl]boronic acid (PubChem CID 156900613) has the molecular formula C28H21BN2O2 and a molecular weight of 428.30 g/mol. Its IUPAC name is [3-[6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]phenyl]boronic acid.
| Compound Name | [3-[6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 156900613 |
| Molecular Formula | C28H21BN2O2 |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [3-[6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]phenyl]boronic acid |
| SMILES | OB(O)c1cccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c1 |
| InChI | InChI=1S/C28H21BN2O2/c32-29(33)25-13-7-12-24(18-25)27-19-26(22-10-5-2-6-11-22)30-28(31-27)23-16-14-21(15-17-23)20-8-3-1-4-9-20/h1-19,32-33H |
| InChIKey | HWKLGKNGLYVWDU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|