C22H17BN2O2 — CID 171054914
[6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]boronic acid (PubChem CID 171054914) has the molecular formula C22H17BN2O2 and a molecular weight of 352.20 g/mol. Its IUPAC name is [6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]boronic acid.
| Compound Name | [6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]boronic acid |
|---|---|
| PubChem CID | 171054914 |
| Molecular Formula | C22H17BN2O2 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [6-phenyl-2-(4-phenylphenyl)pyrimidin-4-yl]boronic acid |
| SMILES | OB(O)c1cc(-c2ccccc2)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H17BN2O2/c26-23(27)21-15-20(18-9-5-2-6-10-18)24-22(25-21)19-13-11-17(12-14-19)16-7-3-1-4-8-16/h1-15,26-27H |
| InChIKey | VXYFQRODAMFNRK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|