C21H16BN3O2 — CID 156900610
[4-(4-phenyl-6-pyridin-2-ylpyrimidin-2-yl)phenyl]boronic acid (PubChem CID 156900610) has the molecular formula C21H16BN3O2 and a molecular weight of 353.19 g/mol. Its IUPAC name is [4-(4-phenyl-6-pyridin-2-ylpyrimidin-2-yl)phenyl]boronic acid.
| Compound Name | [4-(4-phenyl-6-pyridin-2-ylpyrimidin-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 156900610 |
| Molecular Formula | C21H16BN3O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [4-(4-phenyl-6-pyridin-2-ylpyrimidin-2-yl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2nc(-c3ccccc3)cc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C21H16BN3O2/c26-22(27)17-11-9-16(10-12-17)21-24-19(15-6-2-1-3-7-15)14-20(25-21)18-8-4-5-13-23-18/h1-14,26-27H |
| InChIKey | QNLQYDAEHDRKPJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|