C45H31N3 — CID 122549117
4,6-diphenyl-2-[3-(4-phenylphenyl)-5-(4-pyridin-2-ylphenyl)phenyl]pyrimidine (PubChem CID 122549117) has the molecular formula C45H31N3 and a molecular weight of 613.76 g/mol. Its IUPAC name is 4,6-diphenyl-2-[3-(4-phenylphenyl)-5-(4-pyridin-2-ylphenyl)phenyl]pyrimidine.
| Compound Name | 4,6-diphenyl-2-[3-(4-phenylphenyl)-5-(4-pyridin-2-ylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 122549117 |
| Molecular Formula | C45H31N3 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 4,6-diphenyl-2-[3-(4-phenylphenyl)-5-(4-pyridin-2-ylphenyl)phenyl]pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccn5)cc4)cc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)cc2)cc1 |
| InChI | InChI=1S/C45H31N3/c1-4-12-32(13-5-1)33-19-21-34(22-20-33)39-28-40(35-23-25-38(26-24-35)42-18-10-11-27-46-42)30-41(29-39)45-47-43(36-14-6-2-7-15-36)31-44(48-45)37-16-8-3-9-17-37/h1-31H |
| InChIKey | YFUKCNVZYZQLFB-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |